C10H14N2O6S — CID 8501055
methyl N-[(2,5-dimethoxyphenyl)sulfonylamino]carbamate (PubChem CID 8501055) has the molecular formula C10H14N2O6S and a molecular weight of 290.30 g/mol. Its IUPAC name is methyl N-[(2,5-dimethoxyphenyl)sulfonylamino]carbamate.
| Compound Name | methyl N-[(2,5-dimethoxyphenyl)sulfonylamino]carbamate |
|---|---|
| PubChem CID | 8501055 |
| Molecular Formula | C10H14N2O6S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl N-[(2,5-dimethoxyphenyl)sulfonylamino]carbamate |
| SMILES | COC(=O)NNS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H14N2O6S/c1-16-7-4-5-8(17-2)9(6-7)19(14,15)12-11-10(13)18-3/h4-6,12H,1-3H3,(H,11,13) |
| InChIKey | RTKVBXURXQTYAC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|