C14H17N3O5S2 — CID 4828143
N'-(2,5-dimethoxyphenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 4828143) has the molecular formula C14H17N3O5S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N'-(2,5-dimethoxyphenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-(2,5-dimethoxyphenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 4828143 |
| Molecular Formula | C14H17N3O5S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N'-(2,5-dimethoxyphenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NNC(=O)Cc2csc(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O5S2/c1-9-15-10(8-23-9)6-14(18)16-17-24(19,20)13-7-11(21-2)4-5-12(13)22-3/h4-5,7-8,17H,6H2,1-3H3,(H,16,18) |
| InChIKey | MJKRKWSAECGXLP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|