C15H17N3O3S2 — CID 4827990
N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 4827990) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 4827990 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | Cc1nc(CC(=O)NNS(=O)(=O)c2ccc3c(c2)CCC3)cs1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-10-16-13(9-22-10)8-15(19)17-18-23(20,21)14-6-5-11-3-2-4-12(11)7-14/h5-7,9,18H,2-4,8H2,1H3,(H,17,19) |
| InChIKey | OGPMCKSRGNLESN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|