C12H17NO6S — CID 47347665
N-(2,5-dimethoxyphenyl)sulfonyl-2-methoxypropanamide (PubChem CID 47347665) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)sulfonyl-2-methoxypropanamide.
| Compound Name | N-(2,5-dimethoxyphenyl)sulfonyl-2-methoxypropanamide |
|---|---|
| PubChem CID | 47347665 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)sulfonyl-2-methoxypropanamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(=O)C(C)OC)c1 |
| InChI | InChI=1S/C12H17NO6S/c1-8(17-2)12(14)13-20(15,16)11-7-9(18-3)5-6-10(11)19-4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | YYWYRBBSCRXGAC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |