C14H17N5O7S — CID 12875194
1-(2,5-dimethoxyphenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea (PubChem CID 12875194) has the molecular formula C14H17N5O7S and a molecular weight of 399.39 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 12875194 |
| Molecular Formula | C14H17N5O7S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(=O)Nc2nc(OC)nc(OC)n2)c1 |
| InChI | InChI=1S/C14H17N5O7S/c1-23-8-5-6-9(24-2)10(7-8)27(21,22)19-12(20)15-11-16-13(25-3)18-14(17-11)26-4/h5-7H,1-4H3,(H2,15,16,17,18,19,20) |
| InChIKey | CKMXSSJNLLCONF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |