C12H13N5O5S — CID 14835177
1-(benzenesulfonyl)-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea (PubChem CID 14835177) has the molecular formula C12H13N5O5S and a molecular weight of 339.33 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-(benzenesulfonyl)-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 14835177 |
| Molecular Formula | C12H13N5O5S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea |
| SMILES | COc1nc(NC(=O)NS(=O)(=O)c2ccccc2)nc(OC)n1 |
| InChI | InChI=1S/C12H13N5O5S/c1-21-11-14-9(15-12(16-11)22-2)13-10(18)17-23(19,20)8-6-4-3-5-7-8/h3-7H,1-2H3,(H2,13,14,15,16,17,18) |
| InChIKey | RSIQKLAMUSIUQA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |