C11H10ClN5O4S — CID 88777457
1-(benzenesulfonyl)-3-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)urea (PubChem CID 88777457) has the molecular formula C11H10ClN5O4S and a molecular weight of 343.75 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)urea.
| Compound Name | 1-(benzenesulfonyl)-3-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)urea |
|---|---|
| PubChem CID | 88777457 |
| Molecular Formula | C11H10ClN5O4S |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(4-chloro-6-methoxy-1,3,5-triazin-2-yl)urea |
| SMILES | COc1nc(Cl)nc(NC(=O)NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C11H10ClN5O4S/c1-21-11-14-8(12)13-9(16-11)15-10(18)17-22(19,20)7-5-3-2-4-6-7/h2-6H,1H3,(H2,13,14,15,16,17,18) |
| InChIKey | QPURUCSODOXGRM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |