C10H8Cl2N6O3S — CID 134116858
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-3-(2-chlorophenyl)sulfonylurea (PubChem CID 134116858) has the molecular formula C10H8Cl2N6O3S and a molecular weight of 363.19 g/mol. Its IUPAC name is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-3-(2-chlorophenyl)sulfonylurea.
| Compound Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-3-(2-chlorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 134116858 |
| Molecular Formula | C10H8Cl2N6O3S |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-3-(2-chlorophenyl)sulfonylurea |
| SMILES | Nc1nc(Cl)nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N6O3S/c11-5-3-1-2-4-6(5)22(20,21)18-10(19)17-9-15-7(12)14-8(13)16-9/h1-4H,(H4,13,14,15,16,17,18,19) |
| InChIKey | INZJRSPHVZZBOS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |