C17H19ClN6O3S3 — CID 3639083
prop-2-enyl N-[[2-[(2-chlorophenyl)sulfonylcarbamoylamino]-6-methylpyrimidin-4-yl]-methylamino]carbamodithioate (PubChem CID 3639083) has the molecular formula C17H19ClN6O3S3 and a molecular weight of 487.03 g/mol. Its IUPAC name is prop-2-enyl N-[[2-[(2-chlorophenyl)sulfonylcarbamoylamino]-6-methylpyrimidin-4-yl]-methylamino]carbamodithioate.
| Compound Name | prop-2-enyl N-[[2-[(2-chlorophenyl)sulfonylcarbamoylamino]-6-methylpyrimidin-4-yl]-methylamino]carbamodithioate |
|---|---|
| PubChem CID | 3639083 |
| Molecular Formula | C17H19ClN6O3S3 |
| Molecular Weight | 487.03 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | prop-2-enyl N-[[2-[(2-chlorophenyl)sulfonylcarbamoylamino]-6-methylpyrimidin-4-yl]-methylamino]carbamodithioate |
| SMILES | C=CCSC(=S)NN(C)c1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H19ClN6O3S3/c1-4-9-29-17(28)22-24(3)14-10-11(2)19-15(20-14)21-16(25)23-30(26,27)13-8-6-5-7-12(13)18/h4-8,10H,1,9H2,2-3H3,(H,22,28)(H2,19,20,21,23,25) |
| InChIKey | SAZMXHMGZQSHFZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.03 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|