C12H10ClN5O5S — CID 19864749
1-(4-chloro-6-methylpyrimidin-2-yl)-3-(2-nitrophenyl)sulfonylurea (PubChem CID 19864749) has the molecular formula C12H10ClN5O5S and a molecular weight of 371.76 g/mol. Its IUPAC name is 1-(4-chloro-6-methylpyrimidin-2-yl)-3-(2-nitrophenyl)sulfonylurea.
| Compound Name | 1-(4-chloro-6-methylpyrimidin-2-yl)-3-(2-nitrophenyl)sulfonylurea |
|---|---|
| PubChem CID | 19864749 |
| Molecular Formula | C12H10ClN5O5S |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 1-(4-chloro-6-methylpyrimidin-2-yl)-3-(2-nitrophenyl)sulfonylurea |
| SMILES | Cc1cc(Cl)nc(NC(=O)NS(=O)(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H10ClN5O5S/c1-7-6-10(13)15-11(14-7)16-12(19)17-24(22,23)9-5-3-2-4-8(9)18(20)21/h2-6H,1H3,(H2,14,15,16,17,19) |
| InChIKey | NEGGKZMVUHIVGO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|