C16H19ClN4O — CID 122507249
1-(4-tert-butylphenyl)-3-(4-chloro-6-methylpyrimidin-2-yl)urea (PubChem CID 122507249) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-chloro-6-methylpyrimidin-2-yl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-chloro-6-methylpyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 122507249 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-chloro-6-methylpyrimidin-2-yl)urea |
| SMILES | Cc1cc(Cl)nc(NC(=O)Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C16H19ClN4O/c1-10-9-13(17)20-14(18-10)21-15(22)19-12-7-5-11(6-8-12)16(2,3)4/h5-9H,1-4H3,(H2,18,19,20,21,22) |
| InChIKey | UTXDUWXQYCCNGP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |