C15H12ClN5O — CID 134284665
1-(4-chloro-6-methylpyrimidin-2-yl)-3-isoquinolin-3-ylurea (PubChem CID 134284665) has the molecular formula C15H12ClN5O and a molecular weight of 313.75 g/mol. Its IUPAC name is 1-(4-chloro-6-methylpyrimidin-2-yl)-3-isoquinolin-3-ylurea.
| Compound Name | 1-(4-chloro-6-methylpyrimidin-2-yl)-3-isoquinolin-3-ylurea |
|---|---|
| PubChem CID | 134284665 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-(4-chloro-6-methylpyrimidin-2-yl)-3-isoquinolin-3-ylurea |
| SMILES | Cc1cc(Cl)nc(NC(=O)Nc2cc3ccccc3cn2)n1 |
| InChI | InChI=1S/C15H12ClN5O/c1-9-6-12(16)19-14(18-9)21-15(22)20-13-7-10-4-2-3-5-11(10)8-17-13/h2-8H,1H3,(H2,17,18,19,20,21,22) |
| InChIKey | PVERWCBNPOOJDI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |