C14H13F3N4O3S — CID 1278810
1-(4,6-dimethylpyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 1278810) has the molecular formula C14H13F3N4O3S and a molecular weight of 374.34 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 1278810 |
| Molecular Formula | C14H13F3N4O3S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[2-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H13F3N4O3S/c1-8-7-9(2)19-12(18-8)20-13(22)21-25(23,24)11-6-4-3-5-10(11)14(15,16)17/h3-7H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | YJXKEYDAWGFMRY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |