C13H13N5O6S — CID 70556011
1-(1-hydroxy-4,6-dimethylpyrimidin-2-ylidene)-3-(2-nitrophenyl)sulfonylurea (PubChem CID 70556011) has the molecular formula C13H13N5O6S and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-(1-hydroxy-4,6-dimethylpyrimidin-2-ylidene)-3-(2-nitrophenyl)sulfonylurea.
| Compound Name | 1-(1-hydroxy-4,6-dimethylpyrimidin-2-ylidene)-3-(2-nitrophenyl)sulfonylurea |
|---|---|
| PubChem CID | 70556011 |
| Molecular Formula | C13H13N5O6S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-(1-hydroxy-4,6-dimethylpyrimidin-2-ylidene)-3-(2-nitrophenyl)sulfonylurea |
| SMILES | Cc1cc(C)n(O)c(=NC(=O)NS(=O)(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H13N5O6S/c1-8-7-9(2)17(20)12(14-8)15-13(19)16-25(23,24)11-6-4-3-5-10(11)18(21)22/h3-7,20H,1-2H3,(H,16,19) |
| InChIKey | JRQSSWDDCNKTEN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|