C14H12FN5O4 — CID 134099946
N-[(4,6-dimethylpyrimidin-2-yl)carbamoyl]-2-fluoro-6-nitrobenzamide (PubChem CID 134099946) has the molecular formula C14H12FN5O4 and a molecular weight of 333.28 g/mol. Its IUPAC name is N-[(4,6-dimethylpyrimidin-2-yl)carbamoyl]-2-fluoro-6-nitrobenzamide.
| Compound Name | N-[(4,6-dimethylpyrimidin-2-yl)carbamoyl]-2-fluoro-6-nitrobenzamide |
|---|---|
| PubChem CID | 134099946 |
| Molecular Formula | C14H12FN5O4 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[(4,6-dimethylpyrimidin-2-yl)carbamoyl]-2-fluoro-6-nitrobenzamide |
| SMILES | Cc1cc(C)nc(NC(=O)NC(=O)c2c(F)cccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H12FN5O4/c1-7-6-8(2)17-13(16-7)19-14(22)18-12(21)11-9(15)4-3-5-10(11)20(23)24/h3-6H,1-2H3,(H2,16,17,18,19,21,22) |
| InChIKey | DOUMPNSHAKSLJN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|