C13H11FN2O3 — CID 145019670
N-cyclohexa-1,5-dien-1-yl-2-fluoro-6-nitrobenzamide (PubChem CID 145019670) has the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-2-fluoro-6-nitrobenzamide.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-2-fluoro-6-nitrobenzamide |
|---|---|
| PubChem CID | 145019670 |
| Molecular Formula | C13H11FN2O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-2-fluoro-6-nitrobenzamide |
| SMILES | O=C(NC1=CCCC=C1)c1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11FN2O3/c14-10-7-4-8-11(16(18)19)12(10)13(17)15-9-5-2-1-3-6-9/h2,4-8H,1,3H2,(H,15,17) |
| InChIKey | XVBSLWZZSOEHFH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|