C12H7Br4N5O5S — CID 141066529
1-[5-bromo-4-(tribromomethyl)pyrimidin-2-yl]-3-(2-nitrophenyl)sulfonylurea (PubChem CID 141066529) has the molecular formula C12H7Br4N5O5S and a molecular weight of 652.90 g/mol. Its IUPAC name is 1-[5-bromo-4-(tribromomethyl)pyrimidin-2-yl]-3-(2-nitrophenyl)sulfonylurea.
| Compound Name | 1-[5-bromo-4-(tribromomethyl)pyrimidin-2-yl]-3-(2-nitrophenyl)sulfonylurea |
|---|---|
| PubChem CID | 141066529 |
| Molecular Formula | C12H7Br4N5O5S |
| Molecular Weight | 652.90 g/mol |
| Exact Mass | 648.69 |
| IUPAC Name | 1-[5-bromo-4-(tribromomethyl)pyrimidin-2-yl]-3-(2-nitrophenyl)sulfonylurea |
| SMILES | O=C(Nc1ncc(Br)c(C(Br)(Br)Br)n1)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7Br4N5O5S/c13-6-5-17-10(18-9(6)12(14,15)16)19-11(22)20-27(25,26)8-4-2-1-3-7(8)21(23)24/h1-5H,(H2,17,18,19,20,22) |
| InChIKey | VITLUGLWTCMQDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|