C21H21N5O5S — CID 110161706
4-methyl-2-[methyl(2-phenylethyl)amino]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide (PubChem CID 110161706) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 4-methyl-2-[methyl(2-phenylethyl)amino]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide.
| Compound Name | 4-methyl-2-[methyl(2-phenylethyl)amino]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110161706 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-methyl-2-[methyl(2-phenylethyl)amino]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N(C)CCc2ccccc2)ncc1C(=O)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21N5O5S/c1-15-17(14-22-21(23-15)25(2)13-12-16-8-4-3-5-9-16)20(27)24-32(30,31)19-11-7-6-10-18(19)26(28)29/h3-11,14H,12-13H2,1-2H3,(H,24,27) |
| InChIKey | GQXSBKWILUTWBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|