C28H25N5O5S — CID 110161712
2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-[(3-methylphenyl)methyl]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide (PubChem CID 110161712) has the molecular formula C28H25N5O5S and a molecular weight of 543.61 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-[(3-methylphenyl)methyl]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-[(3-methylphenyl)methyl]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110161712 |
| Molecular Formula | C28H25N5O5S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-[(3-methylphenyl)methyl]-N-(2-nitrophenyl)sulfonylpyrimidine-5-carboxamide |
| SMILES | Cc1cccc(Cc2nc(N3CCc4ccccc4C3)ncc2C(=O)NS(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25N5O5S/c1-19-7-6-8-20(15-19)16-24-23(27(34)31-39(37,38)26-12-5-4-11-25(26)33(35)36)17-29-28(30-24)32-14-13-21-9-2-3-10-22(21)18-32/h2-12,15,17H,13-14,16,18H2,1H3,(H,31,34) |
| InChIKey | MOKSVLWVEIXICL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|