C23H23N5O5S — CID 110161707
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-nitrophenyl)sulfonyl-4-propylpyrimidine-5-carboxamide (PubChem CID 110161707) has the molecular formula C23H23N5O5S and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-nitrophenyl)sulfonyl-4-propylpyrimidine-5-carboxamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-nitrophenyl)sulfonyl-4-propylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 110161707 |
| Molecular Formula | C23H23N5O5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-nitrophenyl)sulfonyl-4-propylpyrimidine-5-carboxamide |
| SMILES | CCCc1nc(N2CCc3ccccc3C2)ncc1C(=O)NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N5O5S/c1-2-7-19-18(22(29)26-34(32,33)21-11-6-5-10-20(21)28(30)31)14-24-23(25-19)27-13-12-16-8-3-4-9-17(16)15-27/h3-6,8-11,14H,2,7,12-13,15H2,1H3,(H,26,29) |
| InChIKey | MLVSNFIDAZFCHM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|