C24H24N2O6S — CID 175659166
2-ethyl-N-(2-nitrophenyl)sulfonyl-4-(2-propoxyphenyl)benzamide (PubChem CID 175659166) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-ethyl-N-(2-nitrophenyl)sulfonyl-4-(2-propoxyphenyl)benzamide.
| Compound Name | 2-ethyl-N-(2-nitrophenyl)sulfonyl-4-(2-propoxyphenyl)benzamide |
|---|---|
| PubChem CID | 175659166 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-ethyl-N-(2-nitrophenyl)sulfonyl-4-(2-propoxyphenyl)benzamide |
| SMILES | CCCOc1ccccc1-c1ccc(C(=O)NS(=O)(=O)c2ccccc2[N+](=O)[O-])c(CC)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-3-15-32-22-11-7-5-9-19(22)18-13-14-20(17(4-2)16-18)24(27)25-33(30,31)23-12-8-6-10-21(23)26(28)29/h5-14,16H,3-4,15H2,1-2H3,(H,25,27) |
| InChIKey | PYQYJBRUHRTVIF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|