C27H32N4O5S — CID 170325053
N-[[5-(2-ethoxyphenyl)-2-[(2R)-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 170325053) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is N-[[5-(2-ethoxyphenyl)-2-[(2R)-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[[5-(2-ethoxyphenyl)-2-[(2R)-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 170325053 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[[5-(2-ethoxyphenyl)-2-[(2R)-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccccc1-c1ccc(N2CCNC[C@H]2CC)c(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H32N4O5S/c1-3-22-19-28-15-16-30(22)24-14-13-20(23-9-5-7-11-26(23)36-4-2)17-21(24)18-29-37(34,35)27-12-8-6-10-25(27)31(32)33/h5-14,17,22,28-29H,3-4,15-16,18-19H2,1-2H3/t22-/m1/s1 |
| InChIKey | GSJXWZIOKJCFBG-JOCHJYFZSA-N |
| XLogP | 4.33 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|