C26H31N5O5S — CID 170325373
N-[[6-(2-ethoxyphenyl)-3-(2-ethylpiperazin-1-yl)-2-pyridinyl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 170325373) has the molecular formula C26H31N5O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is N-[[6-(2-ethoxyphenyl)-3-(2-ethylpiperazin-1-yl)-2-pyridinyl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[[6-(2-ethoxyphenyl)-3-(2-ethylpiperazin-1-yl)-2-pyridinyl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 170325373 |
| Molecular Formula | C26H31N5O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-[[6-(2-ethoxyphenyl)-3-(2-ethylpiperazin-1-yl)-2-pyridinyl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccccc1-c1ccc(N2CCNCC2CC)c(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C26H31N5O5S/c1-3-19-17-27-15-16-30(19)23-14-13-21(20-9-5-7-11-25(20)36-4-2)29-22(23)18-28-37(34,35)26-12-8-6-10-24(26)31(32)33/h5-14,19,27-28H,3-4,15-18H2,1-2H3 |
| InChIKey | YXOJRNPSNGDEOD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|