C10H10N4O4S — CID 54897073
2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide (PubChem CID 54897073) has the molecular formula C10H10N4O4S and a molecular weight of 282.28 g/mol. Its IUPAC name is 2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54897073 |
| Molecular Formula | C10H10N4O4S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCc1cn[nH]c1 |
| InChI | InChI=1S/C10H10N4O4S/c15-14(16)9-3-1-2-4-10(9)19(17,18)13-7-8-5-11-12-6-8/h1-6,13H,7H2,(H,11,12) |
| InChIKey | CASALHCNRGKQBN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|