C10H9FN4O4S — CID 115992191
3-fluoro-2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide (PubChem CID 115992191) has the molecular formula C10H9FN4O4S and a molecular weight of 300.27 g/mol. Its IUPAC name is 3-fluoro-2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide.
| Compound Name | 3-fluoro-2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115992191 |
| Molecular Formula | C10H9FN4O4S |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-fluoro-2-nitro-N-(1H-pyrazol-4-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1c(F)cccc1S(=O)(=O)NCc1cn[nH]c1 |
| InChI | InChI=1S/C10H9FN4O4S/c11-8-2-1-3-9(10(8)15(16)17)20(18,19)14-6-7-4-12-13-5-7/h1-5,14H,6H2,(H,12,13) |
| InChIKey | OLZFMWKFFAAYKS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|