C22H29N3O3 — CID 170325231
4-[2-(aminomethyl)-4-(2-ethoxyphenyl)phenyl]-3-ethylpiperazine-1-carboxylic acid (PubChem CID 170325231) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-4-(2-ethoxyphenyl)phenyl]-3-ethylpiperazine-1-carboxylic acid.
| Compound Name | 4-[2-(aminomethyl)-4-(2-ethoxyphenyl)phenyl]-3-ethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170325231 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-[2-(aminomethyl)-4-(2-ethoxyphenyl)phenyl]-3-ethylpiperazine-1-carboxylic acid |
| SMILES | CCOc1ccccc1-c1ccc(N2CCN(C(=O)O)CC2CC)c(CN)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-18-15-24(22(26)27)11-12-25(18)20-10-9-16(13-17(20)14-23)19-7-5-6-8-21(19)28-4-2/h5-10,13,18H,3-4,11-12,14-15,23H2,1-2H3,(H,26,27) |
| InChIKey | SBQJTVJHKVBGBE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |