C39H44F3N5O7S — CID 170325016
N-(2-aminoethyl)-N-[[5-(2-ethoxyphenyl)-2-[(2R)-4-[4-ethoxy-2-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 170325016) has the molecular formula C39H44F3N5O7S and a molecular weight of 783.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[[5-(2-ethoxyphenyl)-2-[(2R)-4-[4-ethoxy-2-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-[[5-(2-ethoxyphenyl)-2-[(2R)-4-[4-ethoxy-2-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 170325016 |
| Molecular Formula | C39H44F3N5O7S |
| Molecular Weight | 783.87 g/mol |
| Exact Mass | 783.29 |
| IUPAC Name | N-(2-aminoethyl)-N-[[5-(2-ethoxyphenyl)-2-[(2R)-4-[4-ethoxy-2-(trifluoromethyl)benzoyl]-2-ethylpiperazin-1-yl]phenyl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(C(=O)N2CCN(c3ccc(-c4ccccc4OCC)cc3CN(CCN)S(=O)(=O)c3ccccc3[N+](=O)[O-])[C@H](CC)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H44F3N5O7S/c1-4-29-26-44(38(48)32-17-16-30(53-5-2)24-33(32)39(40,41)42)21-22-46(29)34-18-15-27(31-11-7-9-13-36(31)54-6-3)23-28(34)25-45(20-19-43)55(51,52)37-14-10-8-12-35(37)47(49)50/h7-18,23-24,29H,4-6,19-22,25-26,43H2,1-3H3/t29-/m1/s1 |
| InChIKey | LWLWMUYRPICZDZ-GDLZYMKVSA-N |
| XLogP | 6.97 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.87 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|