C15H11F3N2O6S — CID 177397515
N-(2-nitrophenyl)sulfonyl-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 177397515) has the molecular formula C15H11F3N2O6S and a molecular weight of 404.32 g/mol. Its IUPAC name is N-(2-nitrophenyl)sulfonyl-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2-nitrophenyl)sulfonyl-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 177397515 |
| Molecular Formula | C15H11F3N2O6S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-(2-nitrophenyl)sulfonyl-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1[N+](=O)[O-])c1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H11F3N2O6S/c16-15(17,18)9-26-12-7-3-1-5-10(12)14(21)19-27(24,25)13-8-4-2-6-11(13)20(22)23/h1-8H,9H2,(H,19,21) |
| InChIKey | RFHIBRVBMYXFHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|