C14H12F3N3O5S — CID 34139784
2-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzenesulfonamide (PubChem CID 34139784) has the molecular formula C14H12F3N3O5S and a molecular weight of 391.33 g/mol. Its IUPAC name is 2-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34139784 |
| Molecular Formula | C14H12F3N3O5S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-nitro-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCc1cccnc1OCC(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O5S/c15-14(16,17)9-25-13-10(4-3-7-18-13)8-19-26(23,24)12-6-2-1-5-11(12)20(21)22/h1-7,19H,8-9H2 |
| InChIKey | NZRXJVZUTDAEQS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|