C10H8F3NO6S — CID 3421449
2,2,2-trifluoroethyl 2-(2-nitrophenyl)sulfonylacetate (PubChem CID 3421449) has the molecular formula C10H8F3NO6S and a molecular weight of 327.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(2-nitrophenyl)sulfonylacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-(2-nitrophenyl)sulfonylacetate |
|---|---|
| PubChem CID | 3421449 |
| Molecular Formula | C10H8F3NO6S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(2-nitrophenyl)sulfonylacetate |
| SMILES | O=C(CS(=O)(=O)c1ccccc1[N+](=O)[O-])OCC(F)(F)F |
| InChI | InChI=1S/C10H8F3NO6S/c11-10(12,13)6-20-9(15)5-21(18,19)8-4-2-1-3-7(8)14(16)17/h1-4H,5-6H2 |
| InChIKey | KAHJDVVXAMNCGW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|