C16H8F15NO7S2 — CID 21209772
2,2,3,3,4,4,5,5-octafluoropentyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfonylacetate (PubChem CID 21209772) has the molecular formula C16H8F15NO7S2 and a molecular weight of 675.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfonylacetate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfonylacetate |
|---|---|
| PubChem CID | 21209772 |
| Molecular Formula | C16H8F15NO7S2 |
| Molecular Weight | 675.34 g/mol |
| Exact Mass | 674.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)-2-nitrophenyl]sulfonylacetate |
| SMILES | O=C(CS(=O)(=O)c1ccc(S(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H8F15NO7S2/c17-10(18)12(21,22)13(23,24)11(19,20)5-39-9(33)4-41(37,38)8-2-1-6(3-7(8)32(34)35)40(36)16(30,31)14(25,26)15(27,28)29/h1-3,10H,4-5H2 |
| InChIKey | CYCYTHGIVQXMKG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|