C14H8F11NO5S — CID 3553907
2,2,3,3,4,4,5,5-octafluoropentyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate (PubChem CID 3553907) has the molecular formula C14H8F11NO5S and a molecular weight of 511.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate |
|---|---|
| PubChem CID | 3553907 |
| Molecular Formula | C14H8F11NO5S |
| Molecular Weight | 511.27 g/mol |
| Exact Mass | 510.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate |
| SMILES | O=C(CS(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H8F11NO5S/c15-10(16)12(19,20)14(24,25)11(17,18)5-31-9(27)4-32(30)8-2-1-6(13(21,22)23)3-7(8)26(28)29/h1-3,10H,4-5H2 |
| InChIKey | RUZYHRLYUATARP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|