C21H20F3NO5S — CID 40657256
(4-cyclohexylphenyl) 2-[(R)-[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl]acetate (PubChem CID 40657256) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is (4-cyclohexylphenyl) 2-[(R)-[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl]acetate.
| Compound Name | (4-cyclohexylphenyl) 2-[(R)-[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl]acetate |
|---|---|
| PubChem CID | 40657256 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (4-cyclohexylphenyl) 2-[(R)-[2-nitro-4-(trifluoromethyl)phenyl]sulfinyl]acetate |
| SMILES | O=C(C[S@@](=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-])Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H20F3NO5S/c22-21(23,24)16-8-11-19(18(12-16)25(27)28)31(29)13-20(26)30-17-9-6-15(7-10-17)14-4-2-1-3-5-14/h6-12,14H,1-5,13H2/t31-/m1/s1 |
| InChIKey | YFJGNVHKQACPKX-WJOKGBTCSA-N |
| XLogP | 5.37 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|