C17H12F3NO8S2 — CID 5261912
(4-acetylphenyl) 2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylacetate (PubChem CID 5261912) has the molecular formula C17H12F3NO8S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is (4-acetylphenyl) 2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylacetate.
| Compound Name | (4-acetylphenyl) 2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylacetate |
|---|---|
| PubChem CID | 5261912 |
| Molecular Formula | C17H12F3NO8S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | (4-acetylphenyl) 2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfinylacetate |
| SMILES | CC(=O)c1ccc(OC(=O)CS(=O)c2ccc(S(=O)(=O)C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12F3NO8S2/c1-10(22)11-2-4-12(5-3-11)29-16(23)9-30(26)15-7-6-13(8-14(15)21(24)25)31(27,28)17(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | KVXABNLKBOQURZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 137.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|