C19H14F7N3O7S2 — CID 21209883
N-(3-acetamidophenyl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfinylacetamide (PubChem CID 21209883) has the molecular formula C19H14F7N3O7S2 and a molecular weight of 593.46 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfinylacetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfinylacetamide |
|---|---|
| PubChem CID | 21209883 |
| Molecular Formula | C19H14F7N3O7S2 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfinylacetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CS(=O)c2ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14F7N3O7S2/c1-10(30)27-11-3-2-4-12(7-11)28-16(31)9-37(34)15-6-5-13(8-14(15)29(32)33)38(35,36)19(25,26)17(20,21)18(22,23)24/h2-8H,9H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | IMZIRISETVLMNP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|