C14H16F3NO5S — CID 3553905
3-methylbutyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate (PubChem CID 3553905) has the molecular formula C14H16F3NO5S and a molecular weight of 367.35 g/mol. Its IUPAC name is 3-methylbutyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate.
| Compound Name | 3-methylbutyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate |
|---|---|
| PubChem CID | 3553905 |
| Molecular Formula | C14H16F3NO5S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 3-methylbutyl 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfinylacetate |
| SMILES | CC(C)CCOC(=O)CS(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16F3NO5S/c1-9(2)5-6-23-13(19)8-24(22)12-4-3-10(14(15,16)17)7-11(12)18(20)21/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | YGVDKUOLERODLU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|