C12H8F7NO5S2 — CID 3422014
methyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-nitrophenyl]sulfinylacetate (PubChem CID 3422014) has the molecular formula C12H8F7NO5S2 and a molecular weight of 443.32 g/mol. Its IUPAC name is methyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-nitrophenyl]sulfinylacetate.
| Compound Name | methyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-nitrophenyl]sulfinylacetate |
|---|---|
| PubChem CID | 3422014 |
| Molecular Formula | C12H8F7NO5S2 |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | methyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-2-nitrophenyl]sulfinylacetate |
| SMILES | COC(=O)CS(=O)c1ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8F7NO5S2/c1-25-9(21)5-27(24)8-3-2-6(4-7(8)20(22)23)26-12(18,19)10(13,14)11(15,16)17/h2-4H,5H2,1H3 |
| InChIKey | CFIDAYJGYGIYEL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|