C16H9ClF6N2O4S2 — CID 40807329
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(S)-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinyl]acetamide (PubChem CID 40807329) has the molecular formula C16H9ClF6N2O4S2 and a molecular weight of 506.83 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(S)-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinyl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(S)-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinyl]acetamide |
|---|---|
| PubChem CID | 40807329 |
| Molecular Formula | C16H9ClF6N2O4S2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(S)-[2-nitro-4-(trifluoromethylsulfanyl)phenyl]sulfinyl]acetamide |
| SMILES | O=C(C[S@](=O)c1ccc(SC(F)(F)F)cc1[N+](=O)[O-])Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H9ClF6N2O4S2/c17-10-3-1-8(15(18,19)20)5-11(10)24-14(26)7-31(29)13-4-2-9(30-16(21,22)23)6-12(13)25(27)28/h1-6H,7H2,(H,24,26)/t31-/m0/s1 |
| InChIKey | XYUSQHCUMWBNLK-HKBQPEDESA-N |
| XLogP | 5.63 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|