C15H9F12NO6S — CID 21209816
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2-nitrophenyl)sulfonylacetate (PubChem CID 21209816) has the molecular formula C15H9F12NO6S and a molecular weight of 559.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2-nitrophenyl)sulfonylacetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2-nitrophenyl)sulfonylacetate |
|---|---|
| PubChem CID | 21209816 |
| Molecular Formula | C15H9F12NO6S |
| Molecular Weight | 559.28 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2-nitrophenyl)sulfonylacetate |
| SMILES | O=C(CS(=O)(=O)c1ccccc1[N+](=O)[O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H9F12NO6S/c16-10(17)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)6-34-9(29)5-35(32,33)8-4-2-1-3-7(8)28(30)31/h1-4,10H,5-6H2 |
| InChIKey | PJUYDJIBQJWSLN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|