C11H10F3NO10S — CID 159108968
2-(2-nitrophenyl)sulfonylacetic acid;3,3,3-trifluoro-2,2-dihydroxypropanoic acid (PubChem CID 159108968) has the molecular formula C11H10F3NO10S and a molecular weight of 405.26 g/mol. Its IUPAC name is 2-(2-nitrophenyl)sulfonylacetic acid;3,3,3-trifluoro-2,2-dihydroxypropanoic acid.
| Compound Name | 2-(2-nitrophenyl)sulfonylacetic acid;3,3,3-trifluoro-2,2-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 159108968 |
| Molecular Formula | C11H10F3NO10S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 2-(2-nitrophenyl)sulfonylacetic acid;3,3,3-trifluoro-2,2-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)(O)C(F)(F)F.O=C(O)CS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO6S.C3H3F3O4/c10-8(11)5-16(14,15)7-4-2-1-3-6(7)9(12)13;4-3(5,6)2(9,10)1(7)8/h1-4H,5H2,(H,10,11);9-10H,(H,7,8) |
| InChIKey | KEFXEMGQPLEFSV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 192.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|