C11H8F8N2O4S — CID 4177436
1,1,2,2,3,3,4,4-octafluoro-N-[(2-nitrophenyl)sulfonylmethyl]butan-1-amine (PubChem CID 4177436) has the molecular formula C11H8F8N2O4S and a molecular weight of 416.25 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-N-[(2-nitrophenyl)sulfonylmethyl]butan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-N-[(2-nitrophenyl)sulfonylmethyl]butan-1-amine |
|---|---|
| PubChem CID | 4177436 |
| Molecular Formula | C11H8F8N2O4S |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-N-[(2-nitrophenyl)sulfonylmethyl]butan-1-amine |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)CNC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H8F8N2O4S/c12-8(13)9(14,15)10(16,17)11(18,19)20-5-26(24,25)7-4-2-1-3-6(7)21(22)23/h1-4,8,20H,5H2 |
| InChIKey | DMYNWNNBWQPZOG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|