C15H11F8NO6 — CID 91742213
4-O-(3-nitrophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate (PubChem CID 91742213) has the molecular formula C15H11F8NO6 and a molecular weight of 453.24 g/mol. Its IUPAC name is 4-O-(3-nitrophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate.
| Compound Name | 4-O-(3-nitrophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
|---|---|
| PubChem CID | 91742213 |
| Molecular Formula | C15H11F8NO6 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 4-O-(3-nitrophenyl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1cccc([N+](=O)[O-])c1)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H11F8NO6/c16-12(17)14(20,21)15(22,23)13(18,19)7-29-10(25)4-5-11(26)30-9-3-1-2-8(6-9)24(27)28/h1-3,6,12H,4-5,7H2 |
| InChIKey | BOFQALYLHLDHMZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|