C15H8F12N2O8S — CID 21209824
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2,4-dinitrophenyl)sulfonylacetate (PubChem CID 21209824) has the molecular formula C15H8F12N2O8S and a molecular weight of 604.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2,4-dinitrophenyl)sulfonylacetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2,4-dinitrophenyl)sulfonylacetate |
|---|---|
| PubChem CID | 21209824 |
| Molecular Formula | C15H8F12N2O8S |
| Molecular Weight | 604.28 g/mol |
| Exact Mass | 603.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-(2,4-dinitrophenyl)sulfonylacetate |
| SMILES | O=C(CS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H8F12N2O8S/c16-10(17)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)5-37-9(30)4-38(35,36)8-2-1-6(28(31)32)3-7(8)29(33)34/h1-3,10H,4-5H2 |
| InChIKey | GVJWHYJOKBTDKV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|