C18H8F19NO6S2 — CID 21209790
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfanylacetate (PubChem CID 21209790) has the molecular formula C18H8F19NO6S2 and a molecular weight of 759.36 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfanylacetate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 21209790 |
| Molecular Formula | C18H8F19NO6S2 |
| Molecular Weight | 759.36 g/mol |
| Exact Mass | 758.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)-2-nitrophenyl]sulfanylacetate |
| SMILES | O=C(CSc1ccc(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H8F19NO6S2/c19-10(20)12(23,24)14(27,28)15(29,30)13(25,26)11(21,22)5-44-9(39)4-45-8-2-1-6(3-7(8)38(40)41)46(42,43)18(36,37)16(31,32)17(33,34)35/h1-3,10H,4-5H2 |
| InChIKey | AFQVMRTWPSNPPU-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.36 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|