C15H20N2O7S — CID 3250398
ethyl 2-[4-(tert-butylcarbamoyl)-2-nitrophenyl]sulfonylacetate (PubChem CID 3250398) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is ethyl 2-[4-(tert-butylcarbamoyl)-2-nitrophenyl]sulfonylacetate.
| Compound Name | ethyl 2-[4-(tert-butylcarbamoyl)-2-nitrophenyl]sulfonylacetate |
|---|---|
| PubChem CID | 3250398 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | ethyl 2-[4-(tert-butylcarbamoyl)-2-nitrophenyl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)c1ccc(C(=O)NC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O7S/c1-5-24-13(18)9-25(22,23)12-7-6-10(8-11(12)17(20)21)14(19)16-15(2,3)4/h6-8H,5,9H2,1-4H3,(H,16,19) |
| InChIKey | HTAZNICRBIPJTL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|