C18H24N2O7S — CID 3250626
ethyl 2-[4-(cycloheptylcarbamoyl)-2-nitrophenyl]sulfonylacetate (PubChem CID 3250626) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is ethyl 2-[4-(cycloheptylcarbamoyl)-2-nitrophenyl]sulfonylacetate.
| Compound Name | ethyl 2-[4-(cycloheptylcarbamoyl)-2-nitrophenyl]sulfonylacetate |
|---|---|
| PubChem CID | 3250626 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethyl 2-[4-(cycloheptylcarbamoyl)-2-nitrophenyl]sulfonylacetate |
| SMILES | CCOC(=O)CS(=O)(=O)c1ccc(C(=O)NC2CCCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O7S/c1-2-27-17(21)12-28(25,26)16-10-9-13(11-15(16)20(23)24)18(22)19-14-7-5-3-4-6-8-14/h9-11,14H,2-8,12H2,1H3,(H,19,22) |
| InChIKey | INIXXFXPOUVBFT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|