C19H19ClN2O5S — CID 4105633
4-(2-chlorophenyl)sulfonyl-N-cyclohexyl-3-nitrobenzamide (PubChem CID 4105633) has the molecular formula C19H19ClN2O5S and a molecular weight of 422.89 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonyl-N-cyclohexyl-3-nitrobenzamide.
| Compound Name | 4-(2-chlorophenyl)sulfonyl-N-cyclohexyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4105633 |
| Molecular Formula | C19H19ClN2O5S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonyl-N-cyclohexyl-3-nitrobenzamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(S(=O)(=O)c2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19ClN2O5S/c20-15-8-4-5-9-17(15)28(26,27)18-11-10-13(12-16(18)22(24)25)19(23)21-14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7H2,(H,21,23) |
| InChIKey | WYFZHGBEAWXGNA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|