C21H16Cl2N2O5S — CID 4105630
N-[2-(2-chlorophenyl)ethyl]-4-(2-chlorophenyl)sulfonyl-3-nitrobenzamide (PubChem CID 4105630) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-4-(2-chlorophenyl)sulfonyl-3-nitrobenzamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-4-(2-chlorophenyl)sulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 4105630 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-4-(2-chlorophenyl)sulfonyl-3-nitrobenzamide |
| SMILES | O=C(NCCc1ccccc1Cl)c1ccc(S(=O)(=O)c2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c22-16-6-2-1-5-14(16)11-12-24-21(26)15-9-10-20(18(13-15)25(27)28)31(29,30)19-8-4-3-7-17(19)23/h1-10,13H,11-12H2,(H,24,26) |
| InChIKey | YJLOZJXLYKBHPW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|