C23H19Cl2N3O5S — CID 4105634
[4-(2-chlorophenyl)piperazin-1-yl]-[4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]methanone (PubChem CID 4105634) has the molecular formula C23H19Cl2N3O5S and a molecular weight of 520.39 g/mol. Its IUPAC name is [4-(2-chlorophenyl)piperazin-1-yl]-[4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]methanone.
| Compound Name | [4-(2-chlorophenyl)piperazin-1-yl]-[4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 4105634 |
| Molecular Formula | C23H19Cl2N3O5S |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | [4-(2-chlorophenyl)piperazin-1-yl]-[4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)c2ccccc2Cl)c([N+](=O)[O-])c1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H19Cl2N3O5S/c24-17-5-1-3-7-19(17)26-11-13-27(14-12-26)23(29)16-9-10-22(20(15-16)28(30)31)34(32,33)21-8-4-2-6-18(21)25/h1-10,15H,11-14H2 |
| InChIKey | CWYMZUQKSZSCBQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|