C25H24ClN3O5S — CID 4105625
[4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 4105625) has the molecular formula C25H24ClN3O5S and a molecular weight of 514.00 g/mol. Its IUPAC name is [4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4105625 |
| Molecular Formula | C25H24ClN3O5S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | [4-(2-chlorophenyl)sulfonyl-3-nitrophenyl]-[4-(2,3-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(S(=O)(=O)c4ccccc4Cl)c([N+](=O)[O-])c3)CC2)c1C |
| InChI | InChI=1S/C25H24ClN3O5S/c1-17-6-5-8-21(18(17)2)27-12-14-28(15-13-27)25(30)19-10-11-24(22(16-19)29(31)32)35(33,34)23-9-4-3-7-20(23)26/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | XNBAAYGEMVIYKU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|